Products 167021-49-0

CAS 167021-49-0 is the registry number for 2-Methyl-4'-(trifluoromethyl)-1,1'-biphenyl, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

1-methyl-2-[4-(trifluoromethyl)phenyl]benzene (CAS 167021-49-0) is a chemical compound with the molecular formula C14H11F3 and a molecular weight of 236.23 g/mol. IUPAC name: 1-methyl-2-[4-(trifluoromethyl)phenyl]benzene. InChIKey: UBTSZISDJIMIDF-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11F3
Molecular weight236.23 g/mol
IUPAC name1-methyl-2-[4-(trifluoromethyl)phenyl]benzene
InChIKeyUBTSZISDJIMIDF-UHFFFAOYSA-N
SMILESCC1=CC=CC=C1C2=CC=C(C=C2)C(F)(F)F

Computed by PubChem (NCBI)