CAS 1214354-36-5 is the registry number for 2-Methyl-3-(trifluoromethyl)-1,1′-biphenyl, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2-methyl-1-phenyl-3-(trifluoromethyl)benzene (CAS 1214354-36-5) is a chemical compound with the molecular formula C14H11F3 and a molecular weight of 236.23 g/mol. IUPAC name: 2-methyl-1-phenyl-3-(trifluoromethyl)benzene. InChIKey: ULEWDMPSISPSTR-UHFFFAOYSA-N.
| Molecular formula | C14H11F3 |
|---|---|
| Molecular weight | 236.23 g/mol |
| IUPAC name | 2-methyl-1-phenyl-3-(trifluoromethyl)benzene |
| InChIKey | ULEWDMPSISPSTR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1C(F)(F)F)C2=CC=CC=C2 |
Computed by PubChem (NCBI)