CAS 1204296-90-1 appears in our catalog under these names: 6-(2,4-Difluorophenyl)-2-oxo-1,2-dihydropyridine-3-carboxylic acid, 95%, 6-(2,4-Difluorophenyl)-2-oxo-1,2-dihydropyridine-3-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 0,5g, 50mg.
6-(2,4-difluorophenyl)-2-oxo-1H-pyridine-3-carboxylic acid (CAS 1204296-90-1) is a chemical compound with the molecular formula C12H7F2NO3 and a molecular weight of 251.18 g/mol. IUPAC name: 6-(2,4-difluorophenyl)-2-oxo-1H-pyridine-3-carboxylic acid. InChIKey: YZZSXQYEQFSNHH-UHFFFAOYSA-N.
| Molecular formula | C12H7F2NO3 |
|---|---|
| Molecular weight | 251.18 g/mol |
| IUPAC name | 6-(2,4-difluorophenyl)-2-oxo-1H-pyridine-3-carboxylic acid |
| InChIKey | YZZSXQYEQFSNHH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C2=CC=C(C(=O)N2)C(=O)O |
Computed by PubChem (NCBI)