Products 189214-44-6
CAS 189214-44-6 is the registry number for 4-fluoro-2-(4-fluorophenoxy)-1-nitrobenzene, 98%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
4-fluoro-2-(4-fluorophenoxy)-1-nitrobenzene (CAS 189214-44-6) is a chemical compound with the molecular formula C12H7F2NO3 and a molecular weight of 251.18 g/mol. IUPAC name: 4-fluoro-2-(4-fluorophenoxy)-1-nitrobenzene. InChIKey: BSHYRERONUQBAQ-UHFFFAOYSA-N.
| Molecular formula | C12H7F2NO3 |
|---|---|
| Molecular weight | 251.18 g/mol |
| IUPAC name | 4-fluoro-2-(4-fluorophenoxy)-1-nitrobenzene |
| InChIKey | BSHYRERONUQBAQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=C(C=CC(=C2)F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)