Products 1582788-87-1
CAS 1582788-87-1 is the registry number for 3-Descyano Fludioxonil 3-Carboxaldehyde, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 500mg.
4-(2,2-difluoro-1,3-benzodioxol-4-yl)-1H-pyrrole-3-carbaldehyde (CAS 1582788-87-1) is a chemical compound with the molecular formula C12H7F2NO3 and a molecular weight of 251.18 g/mol. IUPAC name: 4-(2,2-difluoro-1,3-benzodioxol-4-yl)-1H-pyrrole-3-carbaldehyde. InChIKey: HEHYPBQFZMBSFB-UHFFFAOYSA-N.
| Molecular formula | C12H7F2NO3 |
|---|---|
| Molecular weight | 251.18 g/mol |
| IUPAC name | 4-(2,2-difluoro-1,3-benzodioxol-4-yl)-1H-pyrrole-3-carbaldehyde |
| InChIKey | HEHYPBQFZMBSFB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)OC(O2)(F)F)C3=CNC=C3C=O |
Computed by PubChem (NCBI)