CAS 1204344-49-9 is the registry number for 3-(tert-butyl)-5-methoxybenzaldehyde, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
3-tert-butyl-5-methoxybenzaldehyde (CAS 1204344-49-9) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: 3-tert-butyl-5-methoxybenzaldehyde. InChIKey: ANJUSRNPYVNHOG-UHFFFAOYSA-N.
| Molecular formula | C12H16O2 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | 3-tert-butyl-5-methoxybenzaldehyde |
| InChIKey | ANJUSRNPYVNHOG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)C=O)OC |
Computed by PubChem (NCBI)