CAS 120445-91-2 is the registry number for ((E)-(1-(4-Methylphenyl)ethylidene)amino)urea, 95%. Offered by: AmBeed. Available pack sizes: 1g.
[(E)-1-(4-methylphenyl)ethylideneamino]urea (CAS 120445-91-2) is a chemical compound with the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. IUPAC name: [(E)-1-(4-methylphenyl)ethylideneamino]urea. InChIKey: UORDOKZAZGHLGC-XYOKQWHBSA-N.
| Molecular formula | C10H13N3O |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | [(E)-1-(4-methylphenyl)ethylideneamino]urea |
| InChIKey | UORDOKZAZGHLGC-XYOKQWHBSA-N |
| SMILES | CC1=CC=C(C=C1)/C(=N/NC(=O)N)/C |
Computed by PubChem (NCBI)