CAS 1204580-77-7 appears in our catalog under these names: 4-Fluorobenzofuran-7-boronic acid, 95%, (4-Fluorobenzofuran-7-yl)boronic acid 95+%, (4-Fluorobenzofuran-7-yl)boronic acid, 95+%, 95+%. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat. Available pack sizes: 250mg, 10g, 5g, 25g, 1g, 100mg.
(4-fluoro-1-benzofuran-7-yl)boronic acid (CAS 1204580-77-7) is a chemical compound with the molecular formula C8H6BFO3 and a molecular weight of 179.94 g/mol. IUPAC name: (4-fluoro-1-benzofuran-7-yl)boronic acid. InChIKey: RHCWCBVBRKJAOU-UHFFFAOYSA-N.
| Molecular formula | C8H6BFO3 |
|---|---|
| Molecular weight | 179.94 g/mol |
| IUPAC name | (4-fluoro-1-benzofuran-7-yl)boronic acid |
| InChIKey | RHCWCBVBRKJAOU-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=C(C=C1)F)C=CO2)(O)O |
Computed by PubChem (NCBI)