CAS 473416-33-0 appears in our catalog under these names: (5-Fluoro-2-benzofuranyl)boronic Acid, (5-Fluorobenzofuran-2-yl)boronic acid 98%, (5-Fluorobenzofuran-2-yl)boronic acid, 98%, 98%, (5-Fluorobenzofuran-2-yl)boronic acid, 98%. Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(5-fluoro-1-benzofuran-2-yl)boronic acid (CAS 473416-33-0) is a chemical compound with the molecular formula C8H6BFO3 and a molecular weight of 179.94 g/mol. IUPAC name: (5-fluoro-1-benzofuran-2-yl)boronic acid. InChIKey: YGLIPSIVUHENTJ-UHFFFAOYSA-N.
| Molecular formula | C8H6BFO3 |
|---|---|
| Molecular weight | 179.94 g/mol |
| IUPAC name | (5-fluoro-1-benzofuran-2-yl)boronic acid |
| InChIKey | YGLIPSIVUHENTJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(O1)C=CC(=C2)F)(O)O |
Computed by PubChem (NCBI)