CAS 1423791-86-9 appears in our catalog under these names: (4-Fluorobenzofuran-2-yl)boronic acid, 95%, (4–Fluorobenzofuran–2–yl)boronic acid, (4-Fluorobenzofuran-2-yl)boronic acid 95%, (4-Fluorobenzofuran-2-yl)boronic acid, 95%, 95%, (4-Fluorobenzofuran-2-yl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 25mg, 50mg.
(4-fluoro-1-benzofuran-2-yl)boronic acid (CAS 1423791-86-9) is a chemical compound with the molecular formula C8H6BFO3 and a molecular weight of 179.94 g/mol. IUPAC name: (4-fluoro-1-benzofuran-2-yl)boronic acid. InChIKey: ANIKDESUQGWETI-UHFFFAOYSA-N.
| Molecular formula | C8H6BFO3 |
|---|---|
| Molecular weight | 179.94 g/mol |
| IUPAC name | (4-fluoro-1-benzofuran-2-yl)boronic acid |
| InChIKey | ANIKDESUQGWETI-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(O1)C=CC=C2F)(O)O |
Computed by PubChem (NCBI)