Products 1204700-53-7
CAS 1204700-53-7 appears in our catalog under these names: 1H-Indole-d5-3-acetamide, >95% (HPLC), Indole-2,4,5,6,7-d5-3-acetamide, 98 atom % D, min 98% Chemical Purity, Indole–3–acetamide–d5, Indole-3-acetamide-d5, 99.99%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 100mg, 10mg, 0,05g, 0,01g, 1mg, 10 mg, 1 mg, 5 mg.
2-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)acetamide (CAS 1204700-53-7) is a chemical compound with the molecular formula C10H10N2O and a molecular weight of 179.23 g/mol. IUPAC name: 2-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)acetamide. InChIKey: ZOAMBXDOGPRZLP-SNOLXCFTSA-N.
| Molecular formula | C10H10N2O |
|---|---|
| Molecular weight | 179.23 g/mol |
| IUPAC name | 2-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)acetamide |
| InChIKey | ZOAMBXDOGPRZLP-SNOLXCFTSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(N2)[2H])CC(=O)N)[2H])[2H] |
Computed by PubChem (NCBI)