CAS 1204811-69-7 appears in our catalog under these names: 3-Bromo-6,7-dimethyl-4-hydroxyquinoline, 95%, 3-Bromo-6,7-dimethylquinolin-4-ol, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
3-bromo-6,7-dimethyl-1H-quinolin-4-one (CAS 1204811-69-7) is a chemical compound with the molecular formula C11H10BrNO and a molecular weight of 252.11 g/mol. IUPAC name: 3-bromo-6,7-dimethyl-1H-quinolin-4-one. InChIKey: JYCOENAJWAVNKI-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO |
|---|---|
| Molecular weight | 252.11 g/mol |
| IUPAC name | 3-bromo-6,7-dimethyl-1H-quinolin-4-one |
| InChIKey | JYCOENAJWAVNKI-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)NC=C(C2=O)Br |
Computed by PubChem (NCBI)