CAS 1205683-33-5 is the registry number for 1-(2-Phenoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2-phenoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 1205683-33-5) is a chemical compound with the molecular formula C17H23BN2O3 and a molecular weight of 314.2 g/mol. IUPAC name: 1-(2-phenoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: GCDFMMCXCDMFMR-UHFFFAOYSA-N.
| Molecular formula | C17H23BN2O3 |
|---|---|
| Molecular weight | 314.2 g/mol |
| IUPAC name | 1-(2-phenoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | GCDFMMCXCDMFMR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)CCOC3=CC=CC=C3 |
Computed by PubChem (NCBI)