CAS 957061-20-0 is the registry number for 4-(2-(1H-Pyrazol-1-yl)ethoxy)phenylboronic acid, pinacol ester, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]pyrazole (CAS 957061-20-0) is a chemical compound with the molecular formula C17H23BN2O3 and a molecular weight of 314.2 g/mol. IUPAC name: 1-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]pyrazole. InChIKey: RHYXZVARIISSFR-UHFFFAOYSA-N.
| Molecular formula | C17H23BN2O3 |
|---|---|
| Molecular weight | 314.2 g/mol |
| IUPAC name | 1-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]pyrazole |
| InChIKey | RHYXZVARIISSFR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCCN3C=CC=N3 |
Computed by PubChem (NCBI)