Products 1488411-05-7
CAS 1488411-05-7 appears in our catalog under these names: 4-Cyano-3-morpholinophenylboronic acid pinacol ester, 98%, 2-Morpholino-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-morpholin-4-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 1488411-05-7) is a chemical compound with the molecular formula C17H23BN2O3 and a molecular weight of 314.2 g/mol. IUPAC name: 2-morpholin-4-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: DZIOXQUWUAJDAC-UHFFFAOYSA-N.
| Molecular formula | C17H23BN2O3 |
|---|---|
| Molecular weight | 314.2 g/mol |
| IUPAC name | 2-morpholin-4-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | DZIOXQUWUAJDAC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C#N)N3CCOCC3 |
Computed by PubChem (NCBI)