Products 1205687-49-5
CAS 1205687-49-5 appears in our catalog under these names: 4'–O–Methylatalantoflavone, 4'-O-Methylatalantoflavone. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
5-hydroxy-2-(4-methoxyphenyl)-8,8-dimethylpyrano[2,3-h]chromen-4-one (CAS 1205687-49-5) is a chemical compound with the molecular formula C21H18O5 and a molecular weight of 350.4 g/mol. IUPAC name: 5-hydroxy-2-(4-methoxyphenyl)-8,8-dimethylpyrano[2,3-h]chromen-4-one. InChIKey: ZBCMZXUJUABTJX-UHFFFAOYSA-N.
| Molecular formula | C21H18O5 |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | 5-hydroxy-2-(4-methoxyphenyl)-8,8-dimethylpyrano[2,3-h]chromen-4-one |
| InChIKey | ZBCMZXUJUABTJX-UHFFFAOYSA-N |
| SMILES | CC1(C=CC2=C(O1)C=C(C3=C2OC(=CC3=O)C4=CC=C(C=C4)OC)O)C |
Computed by PubChem (NCBI)
Synonyms:
4'-O-Methylatalantoflavone, orb1680558