Products 2883506-60-1
CAS 2883506-60-1 is the registry number for Nrf2/HO-1 activator 1. Offered by: TargetMol, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, Get quote.
5-hydroxy-9-(4-methoxyphenyl)-2,2-dimethylpyrano[2,3-f]chromen-10-one (CAS 2883506-60-1) is a chemical compound with the molecular formula C21H18O5 and a molecular weight of 350.4 g/mol. IUPAC name: 5-hydroxy-9-(4-methoxyphenyl)-2,2-dimethylpyrano[2,3-f]chromen-10-one. InChIKey: VSEYTLWGWLRKQD-UHFFFAOYSA-N.
| Molecular formula | C21H18O5 |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | 5-hydroxy-9-(4-methoxyphenyl)-2,2-dimethylpyrano[2,3-f]chromen-10-one |
| InChIKey | VSEYTLWGWLRKQD-UHFFFAOYSA-N |
| SMILES | CC1(C=CC2=C(O1)C3=C(C=C2O)OC=C(C3=O)C4=CC=C(C=C4)OC)C |
Computed by PubChem (NCBI)
Synonyms:
Nrf2/HO-1 activator 1, orb1688833