Products 929975-44-0

CAS 929975-44-0 is the registry number for 4-(2-(4-Phenoxyphenoxy)ethoxy)benzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

4-[2-(4-phenoxyphenoxy)ethoxy]benzoic acid (CAS 929975-44-0) is a chemical compound with the molecular formula C21H18O5 and a molecular weight of 350.4 g/mol. IUPAC name: 4-[2-(4-phenoxyphenoxy)ethoxy]benzoic acid. InChIKey: CYKLYHQOCRQIOL-UHFFFAOYSA-N.

Identity
Molecular formulaC21H18O5
Molecular weight350.4 g/mol
IUPAC name4-[2-(4-phenoxyphenoxy)ethoxy]benzoic acid
InChIKeyCYKLYHQOCRQIOL-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)OC2=CC=C(C=C2)OCCOC3=CC=C(C=C3)C(=O)O

Computed by PubChem (NCBI)