CAS 1206-55-9 appears in our catalog under these names: 3,6-Dimethoxy-2-nitrobenzaldehyde, 97%, 3,6-Dimethoxy-2-nitrobenzaldehyde, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg.
3,6-dimethoxy-2-nitrobenzaldehyde (CAS 1206-55-9) is a chemical compound with the molecular formula C9H9NO5 and a molecular weight of 211.17 g/mol. IUPAC name: 3,6-dimethoxy-2-nitrobenzaldehyde. InChIKey: IOHYBMYWODOPEY-UHFFFAOYSA-N.
| Molecular formula | C9H9NO5 |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | 3,6-dimethoxy-2-nitrobenzaldehyde |
| InChIKey | IOHYBMYWODOPEY-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)OC)[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)