CAS 1206181-50-1 appears in our catalog under these names: 5-(Benzyloxy)-4,6-dichloropyrimidine, 98%, 5-(Benzyloxy)-4,6-dichloropyrimidine, 95%, 95%, 5-(Benzyloxy)-4,6-dichloropyrimidine, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 25g, 10g, 100mg, 250mg, 1g, 5g.
4,6-dichloro-5-phenylmethoxypyrimidine (CAS 1206181-50-1) is a chemical compound with the molecular formula C11H8Cl2N2O and a molecular weight of 255.10 g/mol. IUPAC name: 4,6-dichloro-5-phenylmethoxypyrimidine. InChIKey: LAVPRNBTAJISIC-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2N2O |
|---|---|
| Molecular weight | 255.10 g/mol |
| IUPAC name | 4,6-dichloro-5-phenylmethoxypyrimidine |
| InChIKey | LAVPRNBTAJISIC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(N=CN=C2Cl)Cl |
Computed by PubChem (NCBI)