Products 1206456-44-1
CAS 1206456-44-1 appears in our catalog under these names: Olopatadine Impurity 10, Olopatadine Impurity 7, Olopatadine Isopropyl Ester, >95% (HPLC), Olopatadine Isopropyl Ester. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Propan-2-yl 2-[(11Z)-11-[3-(dimethylamino)propylidene]-6H-benzo[c][1]benzoxepin-2-yl]acetate (CAS 1206456-44-1) is a chemical compound with the molecular formula C24H29NO3 and a molecular weight of 379.5 g/mol. IUPAC name: propan-2-yl 2-[(11Z)-11-[3-(dimethylamino)propylidene]-6H-benzo[c][1]benzoxepin-2-yl]acetate. InChIKey: AEZOYXJGZPHCRI-FBHDLOMBSA-N.
| Molecular formula | C24H29NO3 |
|---|---|
| Molecular weight | 379.5 g/mol |
| IUPAC name | propan-2-yl 2-[(11Z)-11-[3-(dimethylamino)propylidene]-6H-benzo[c][1]benzoxepin-2-yl]acetate |
| InChIKey | AEZOYXJGZPHCRI-FBHDLOMBSA-N |
| SMILES | CC(C)OC(=O)CC1=CC\2=C(C=C1)OCC3=CC=CC=C3/C2=C/CCN(C)C |
Computed by PubChem (NCBI)