Products 932736-90-8
CAS 932736-90-8 appears in our catalog under these names: (±)–PPCC oxalate, (±)-PPCC. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 50mg, Get quote.
Cis-methyl (1S,2R)-2-[(4-hydroxy-4-phenylpiperidin-1-yl)methyl]-1-(4-methylphenyl)cyclopropane-1-carboxylate (CAS 932736-90-8) is a chemical compound with the molecular formula C24H29NO3 and a molecular weight of 379.5 g/mol. IUPAC name: cis-methyl (1S,2R)-2-[(4-hydroxy-4-phenylpiperidin-1-yl)methyl]-1-(4-methylphenyl)cyclopropane-1-carboxylate. InChIKey: BDSYECBSUUOPCT-XUZZJYLKSA-N.
| Molecular formula | C24H29NO3 |
|---|---|
| Molecular weight | 379.5 g/mol |
| IUPAC name | cis-methyl (1S,2R)-2-[(4-hydroxy-4-phenylpiperidin-1-yl)methyl]-1-(4-methylphenyl)cyclopropane-1-carboxylate |
| InChIKey | BDSYECBSUUOPCT-XUZZJYLKSA-N |
| SMILES | CC1=CC=C(C=C1)[C@@]2(C[C@H]2CN3CCC(CC3)(C4=CC=CC=C4)O)C(=O)OC |
Computed by PubChem (NCBI)