CAS 127697-58-9 appears in our catalog under these names: SRI 6409-94, SRI 6409–94, SRI 6409-94, 98.60%, 98.60%, SRI 6409-94, 99.25%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 2mg, 10mg, 100mg, 25mg, 5mg, 50mg, 1mg, 50 mg.
Ethyl 4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carbonyl)amino]benzoate (CAS 127697-58-9) is a chemical compound with the molecular formula C24H29NO3 and a molecular weight of 379.5 g/mol. IUPAC name: ethyl 4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carbonyl)amino]benzoate. InChIKey: BACPJFZYTZYCNF-UHFFFAOYSA-N.
| Molecular formula | C24H29NO3 |
|---|---|
| Molecular weight | 379.5 g/mol |
| IUPAC name | ethyl 4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carbonyl)amino]benzoate |
| InChIKey | BACPJFZYTZYCNF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)NC(=O)C2=CC3=C(C=C2)C(CCC3(C)C)(C)C |
Computed by PubChem (NCBI)