CAS 1206593-32-9 appears in our catalog under these names: 3-Fluoro-4-(3-chloro-2-fluorophenoxy)aniline, 95%, 4-(3-Chloro-2-fluorophenoxy)-3-fluoroaniline, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g.
4-(3-chloro-2-fluorophenoxy)-3-fluoroaniline (CAS 1206593-32-9) is a chemical compound with the molecular formula C12H8ClF2NO and a molecular weight of 255.65 g/mol. IUPAC name: 4-(3-chloro-2-fluorophenoxy)-3-fluoroaniline. InChIKey: VLAMCDVNMXJZMN-UHFFFAOYSA-N.
| Molecular formula | C12H8ClF2NO |
|---|---|
| Molecular weight | 255.65 g/mol |
| IUPAC name | 4-(3-chloro-2-fluorophenoxy)-3-fluoroaniline |
| InChIKey | VLAMCDVNMXJZMN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)F)OC2=C(C=C(C=C2)N)F |
Computed by PubChem (NCBI)