CAS 549547-33-3 appears in our catalog under these names: 4-(4-Chlorophenoxy)-3,5-difluoroaniline, 95%, 4-(4-Chlorophenoxy)-3,5-difluoroaniline, 98%, 98%, 4-(4-Chlorophenoxy)-3,5-difluoroaniline, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
4-(4-chlorophenoxy)-3,5-difluoroaniline (CAS 549547-33-3) is a chemical compound with the molecular formula C12H8ClF2NO and a molecular weight of 255.65 g/mol. IUPAC name: 4-(4-chlorophenoxy)-3,5-difluoroaniline. InChIKey: TVINDEPPMFUWBQ-UHFFFAOYSA-N.
| Molecular formula | C12H8ClF2NO |
|---|---|
| Molecular weight | 255.65 g/mol |
| IUPAC name | 4-(4-chlorophenoxy)-3,5-difluoroaniline |
| InChIKey | TVINDEPPMFUWBQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=C(C=C(C=C2F)N)F)Cl |
Computed by PubChem (NCBI)