Products 2918837-45-1
CAS 2918837-45-1 is the registry number for (5-chloro-2,3-difluoropyridin-4-yl)(phenyl)methanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(5-chloro-2,3-difluoro-4-pyridinyl)-phenylmethanol (CAS 2918837-45-1) is a chemical compound with the molecular formula C12H8ClF2NO and a molecular weight of 255.65 g/mol. IUPAC name: (5-chloro-2,3-difluoro-4-pyridinyl)-phenylmethanol. InChIKey: DDRMLVDNMLXTGO-UHFFFAOYSA-N.
| Molecular formula | C12H8ClF2NO |
|---|---|
| Molecular weight | 255.65 g/mol |
| IUPAC name | (5-chloro-2,3-difluoro-4-pyridinyl)-phenylmethanol |
| InChIKey | DDRMLVDNMLXTGO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=C(C(=NC=C2Cl)F)F)O |
Computed by PubChem (NCBI)