Products 127214-85-1
CAS 127214-85-1 is the registry number for Bisacurone B. Offered by: MedChemExpress. Available pack sizes: Get quote.
(6S)-6-[(1R,4S,5R)-4,5-dihydroxy-4-methylcyclohex-2-en-1-yl]-2-methylhept-2-en-4-one (CAS 127214-85-1) is a chemical compound with the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. IUPAC name: (6S)-6-[(1R,4S,5R)-4,5-dihydroxy-4-methylcyclohex-2-en-1-yl]-2-methylhept-2-en-4-one. InChIKey: QJOWFYQIUZMPRY-MXYBEHONSA-N.
| Molecular formula | C15H24O3 |
|---|---|
| Molecular weight | 252.35 g/mol |
| IUPAC name | (6S)-6-[(1R,4S,5R)-4,5-dihydroxy-4-methylcyclohex-2-en-1-yl]-2-methylhept-2-en-4-one |
| InChIKey | QJOWFYQIUZMPRY-MXYBEHONSA-N |
| SMILES | C[C@@H](CC(=O)C=C(C)C)[C@H]1C[C@H]([C@@](C=C1)(C)O)O |
Computed by PubChem (NCBI)