Products 1206969-78-9

CAS 1206969-78-9 is the registry number for 3-(1-(2-(Dimethylamino)ethyl)-1h-pyrazol-4-yl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.

Structural formula: {0} (CAS {1})

3-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]benzoic acid (CAS 1206969-78-9) is a chemical compound with the molecular formula C14H17N3O2 and a molecular weight of 259.30 g/mol. IUPAC name: 3-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]benzoic acid. InChIKey: HVGUERNNMJSANR-UHFFFAOYSA-N.

Identity
Molecular formulaC14H17N3O2
Molecular weight259.30 g/mol
IUPAC name3-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]benzoic acid
InChIKeyHVGUERNNMJSANR-UHFFFAOYSA-N
SMILESCN(C)CCN1C=C(C=N1)C2=CC(=CC=C2)C(=O)O

Computed by PubChem (NCBI)