CAS 1209368-38-6 is the registry number for 4-Nitro-1,5,6,7-tetrahydro-5,5,7,7-tetramethylcyclopenta[f]indazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5,5,7,7-tetramethyl-4-nitro-1,6-dihydrocyclopenta[f]indazole (CAS 1209368-38-6) is a chemical compound with the molecular formula C14H17N3O2 and a molecular weight of 259.30 g/mol. IUPAC name: 5,5,7,7-tetramethyl-4-nitro-1,6-dihydrocyclopenta[f]indazole. InChIKey: UTYQIVLMFOMOEV-UHFFFAOYSA-N.
| Molecular formula | C14H17N3O2 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | 5,5,7,7-tetramethyl-4-nitro-1,6-dihydrocyclopenta[f]indazole |
| InChIKey | UTYQIVLMFOMOEV-UHFFFAOYSA-N |
| SMILES | CC1(CC(C2=C(C3=C(C=C21)NN=C3)[N+](=O)[O-])(C)C)C |
Computed by PubChem (NCBI)