CAS 1799974-75-6 is the registry number for (E)-Ethyl 3-(1-ethyl-4-methyl-1h-benzo[d][1,2,3]triazol-5-yl)acrylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl (E)-3-(1-ethyl-4-methylbenzotriazol-5-yl)prop-2-enoate (CAS 1799974-75-6) is a chemical compound with the molecular formula C14H17N3O2 and a molecular weight of 259.30 g/mol. IUPAC name: ethyl (E)-3-(1-ethyl-4-methylbenzotriazol-5-yl)prop-2-enoate. InChIKey: CVWPPIQEMSUVLI-VQHVLOKHSA-N.
| Molecular formula | C14H17N3O2 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | ethyl (E)-3-(1-ethyl-4-methylbenzotriazol-5-yl)prop-2-enoate |
| InChIKey | CVWPPIQEMSUVLI-VQHVLOKHSA-N |
| SMILES | CCN1C2=C(C(=C(C=C2)/C=C/C(=O)OCC)C)N=N1 |
Computed by PubChem (NCBI)