CAS 1207062-35-8 is the registry number for (Z)-2-(2-(4-Bromophenyl)hydrazono)-2-chloroacetaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 250mg.
(1Z)-N-(4-bromophenyl)-2-oxoethanehydrazonoyl chloride (CAS 1207062-35-8) is a chemical compound with the molecular formula C8H6BrClN2O and a molecular weight of 261.50 g/mol. IUPAC name: (1Z)-N-(4-bromophenyl)-2-oxoethanehydrazonoyl chloride. InChIKey: OHLOPSVBMLNQSD-WQLSENKSSA-N.
| Molecular formula | C8H6BrClN2O |
|---|---|
| Molecular weight | 261.50 g/mol |
| IUPAC name | (1Z)-N-(4-bromophenyl)-2-oxoethanehydrazonoyl chloride |
| InChIKey | OHLOPSVBMLNQSD-WQLSENKSSA-N |
| SMILES | C1=CC(=CC=C1N/N=C(/C=O)\Cl)Br |
Computed by PubChem (NCBI)