Products 1884164-79-7
CAS 1884164-79-7 is the registry number for 7-Bromo-4-chloro-1-methyl-1,2-dihydro-3H-indazol-3-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-4-chloro-1-methyl-2H-indazol-3-one (CAS 1884164-79-7) is a chemical compound with the molecular formula C8H6BrClN2O and a molecular weight of 261.50 g/mol. IUPAC name: 7-bromo-4-chloro-1-methyl-2H-indazol-3-one. InChIKey: RSVZIRZPEQRXBB-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClN2O |
|---|---|
| Molecular weight | 261.50 g/mol |
| IUPAC name | 7-bromo-4-chloro-1-methyl-2H-indazol-3-one |
| InChIKey | RSVZIRZPEQRXBB-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2C(=O)N1)Cl)Br |
Computed by PubChem (NCBI)