Products 2088164-83-2
CAS 2088164-83-2 is the registry number for 7-Bromo-8-chloro-3,4-dihydroquinoxalin-2(1H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-8-chloro-3,4-dihydro-1H-quinoxalin-2-one (CAS 2088164-83-2) is a chemical compound with the molecular formula C8H6BrClN2O and a molecular weight of 261.50 g/mol. IUPAC name: 7-bromo-8-chloro-3,4-dihydro-1H-quinoxalin-2-one. InChIKey: XNMKRVCHPZZNFO-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClN2O |
|---|---|
| Molecular weight | 261.50 g/mol |
| IUPAC name | 7-bromo-8-chloro-3,4-dihydro-1H-quinoxalin-2-one |
| InChIKey | XNMKRVCHPZZNFO-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(N1)C=CC(=C2Cl)Br |
Computed by PubChem (NCBI)