CAS 1207068-15-2 is the registry number for Clevidipine Impurity 9. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
Methyl 6-(2,3-dichlorophenyl)-4-methyl-2-oxocyclohex-3-ene-1-carboxylate (CAS 1207068-15-2) is a chemical compound with the molecular formula C15H14Cl2O3 and a molecular weight of 313.2 g/mol. IUPAC name: methyl 6-(2,3-dichlorophenyl)-4-methyl-2-oxocyclohex-3-ene-1-carboxylate. InChIKey: LKPBSDUBXNOVSY-UHFFFAOYSA-N.
| Molecular formula | C15H14Cl2O3 |
|---|---|
| Molecular weight | 313.2 g/mol |
| IUPAC name | methyl 6-(2,3-dichlorophenyl)-4-methyl-2-oxocyclohex-3-ene-1-carboxylate |
| InChIKey | LKPBSDUBXNOVSY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C(C(C1)C2=C(C(=CC=C2)Cl)Cl)C(=O)OC |
Computed by PubChem (NCBI)