Products 1207068-15-2

CAS 1207068-15-2 is the registry number for Clevidipine Impurity 9. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

Methyl 6-(2,3-dichlorophenyl)-4-methyl-2-oxocyclohex-3-ene-1-carboxylate (CAS 1207068-15-2) is a chemical compound with the molecular formula C15H14Cl2O3 and a molecular weight of 313.2 g/mol. IUPAC name: methyl 6-(2,3-dichlorophenyl)-4-methyl-2-oxocyclohex-3-ene-1-carboxylate. InChIKey: LKPBSDUBXNOVSY-UHFFFAOYSA-N.

Identity
Molecular formulaC15H14Cl2O3
Molecular weight313.2 g/mol
IUPAC namemethyl 6-(2,3-dichlorophenyl)-4-methyl-2-oxocyclohex-3-ene-1-carboxylate
InChIKeyLKPBSDUBXNOVSY-UHFFFAOYSA-N
SMILESCC1=CC(=O)C(C(C1)C2=C(C(=CC=C2)Cl)Cl)C(=O)OC

Computed by PubChem (NCBI)