CAS 148476-22-6 appears in our catalog under these names: Spirodiclofen Impurity 1, O-Des-(2,2-methylbutyryl) Spirodiclofen, >95% (HPLC), Spirodiclofen-enol, 3-(2,4-Dichlorophenyl)-4-hydroxy-1-oxaspiro(4.5)dec-3-en-2-one. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, Biosynth, HPC Standards. Available pack sizes: on request, 100mg, 10mg, 50mg, 0,5g, 1x10mg.
3-(2,4-dichlorophenyl)-4-hydroxy-1-oxaspiro[4.5]dec-3-en-2-one (CAS 148476-22-6) is a chemical compound with the molecular formula C15H14Cl2O3 and a molecular weight of 313.2 g/mol. IUPAC name: 3-(2,4-dichlorophenyl)-4-hydroxy-1-oxaspiro[4.5]dec-3-en-2-one. InChIKey: KIKARNYYJSEROI-UHFFFAOYSA-N.
| Molecular formula | C15H14Cl2O3 |
|---|---|
| Molecular weight | 313.2 g/mol |
| IUPAC name | 3-(2,4-dichlorophenyl)-4-hydroxy-1-oxaspiro[4.5]dec-3-en-2-one |
| InChIKey | KIKARNYYJSEROI-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)C(=C(C(=O)O2)C3=C(C=C(C=C3)Cl)Cl)O |
Computed by PubChem (NCBI)