CAS 872196-89-9 is the registry number for (4-[(2,4-Dichlorobenzyl)oxy]-3-methoxyphenyl)methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methanol (CAS 872196-89-9) is a chemical compound with the molecular formula C15H14Cl2O3 and a molecular weight of 313.2 g/mol. IUPAC name: [4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methanol. InChIKey: QPQJDZDLRQKFJF-UHFFFAOYSA-N.
| Molecular formula | C15H14Cl2O3 |
|---|---|
| Molecular weight | 313.2 g/mol |
| IUPAC name | [4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methanol |
| InChIKey | QPQJDZDLRQKFJF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)CO)OCC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)