Products 1207281-29-5
CAS 1207281-29-5 is the registry number for Oxyfluorfen Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
1-chloro-2-(3-ethoxy-4-nitrophenoxy)-4-(trifluoromethyl)benzene (CAS 1207281-29-5) is a chemical compound with the molecular formula C15H11ClF3NO4 and a molecular weight of 361.70 g/mol. IUPAC name: 1-chloro-2-(3-ethoxy-4-nitrophenoxy)-4-(trifluoromethyl)benzene. InChIKey: FOVQBHZSDNJRFM-UHFFFAOYSA-N.
| Molecular formula | C15H11ClF3NO4 |
|---|---|
| Molecular weight | 361.70 g/mol |
| IUPAC name | 1-chloro-2-(3-ethoxy-4-nitrophenoxy)-4-(trifluoromethyl)benzene |
| InChIKey | FOVQBHZSDNJRFM-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)OC2=C(C=CC(=C2)C(F)(F)F)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)