Products 127893-34-9
CAS 127893-34-9 appears in our catalog under these names: Haloxyfop-d4, (±)-Haloxyfop-d4, >95% (HPLC), Haloxyfop (free acid) D4 (phenoxy D4), Haloxyfop (free acid) D4 (phenoxy-D4) 100 µg/mL in Acetonitrile. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, Biosynth, MedChemExpress. Available pack sizes: on request, 2,5mg, 25mg, 10mg, 1ml, 1mg, 5mg, 50mg.
2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2,3,5,6-tetradeuteriophenoxy]propanoic acid (CAS 127893-34-9) is a chemical compound with the molecular formula C15H11ClF3NO4 and a molecular weight of 365.72 g/mol. IUPAC name: 2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2,3,5,6-tetradeuteriophenoxy]propanoic acid. InChIKey: GOCUAJYOYBLQRH-QFFDRWTDSA-N.
| Molecular formula | C15H11ClF3NO4 |
|---|---|
| Molecular weight | 365.72 g/mol |
| IUPAC name | 2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2,3,5,6-tetradeuteriophenoxy]propanoic acid |
| InChIKey | GOCUAJYOYBLQRH-QFFDRWTDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1OC2=C(C=C(C=N2)C(F)(F)F)Cl)[2H])[2H])OC(C)C(=O)O)[2H] |
Computed by PubChem (NCBI)