Products 2140327-69-9
CAS 2140327-69-9 appears in our catalog under these names: Oxyfluorfen D5 (ethyl D5), Oxyfluorfen-d5, 99.66%, D5-Oxyfluorfen, D5-Oxyfluorfen, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, MedChemExpress, HPC Standards. Available pack sizes: 100mg, 1 mg, 10 mg, 25 mg, 5 mg, 1x5mg, 1x1ml.
2-chloro-1-[4-nitro-3-(1,1,2,2,2-pentadeuterioethoxy)phenoxy]-4-(trifluoromethyl)benzene (CAS 2140327-69-9) is a chemical compound with the molecular formula C15H11ClF3NO4 and a molecular weight of 366.73 g/mol. IUPAC name: 2-chloro-1-[4-nitro-3-(1,1,2,2,2-pentadeuterioethoxy)phenoxy]-4-(trifluoromethyl)benzene. InChIKey: OQMBBFQZGJFLBU-ZBJDZAJPSA-N.
| Molecular formula | C15H11ClF3NO4 |
|---|---|
| Molecular weight | 366.73 g/mol |
| IUPAC name | 2-chloro-1-[4-nitro-3-(1,1,2,2,2-pentadeuterioethoxy)phenoxy]-4-(trifluoromethyl)benzene |
| InChIKey | OQMBBFQZGJFLBU-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC1=C(C=CC(=C1)OC2=C(C=C(C=C2)C(F)(F)F)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)