CAS 1207384-50-6 is the registry number for 1-(Methyl-d3)-6-oxopyridine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
6-oxo-1-(trideuteriomethyl)pyridine-3-carboxylic acid (CAS 1207384-50-6) is a chemical compound with the molecular formula C7H7NO3 and a molecular weight of 156.15 g/mol. IUPAC name: 6-oxo-1-(trideuteriomethyl)pyridine-3-carboxylic acid. InChIKey: RGZCKPXTNJAWMR-FIBGUPNXSA-N.
| Molecular formula | C7H7NO3 |
|---|---|
| Molecular weight | 156.15 g/mol |
| IUPAC name | 6-oxo-1-(trideuteriomethyl)pyridine-3-carboxylic acid |
| InChIKey | RGZCKPXTNJAWMR-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C=C(C=CC1=O)C(=O)O |
Computed by PubChem (NCBI)