Products 1207384-50-6

CAS 1207384-50-6 is the registry number for 1-(Methyl-d3)-6-oxopyridine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

6-oxo-1-(trideuteriomethyl)pyridine-3-carboxylic acid (CAS 1207384-50-6) is a chemical compound with the molecular formula C7H7NO3 and a molecular weight of 156.15 g/mol. IUPAC name: 6-oxo-1-(trideuteriomethyl)pyridine-3-carboxylic acid. InChIKey: RGZCKPXTNJAWMR-FIBGUPNXSA-N.

Identity
Molecular formulaC7H7NO3
Molecular weight156.15 g/mol
IUPAC name6-oxo-1-(trideuteriomethyl)pyridine-3-carboxylic acid
InChIKeyRGZCKPXTNJAWMR-FIBGUPNXSA-N
SMILES[2H]C([2H])([2H])N1C=C(C=CC1=O)C(=O)O

Computed by PubChem (NCBI)