CAS 5428-54-6 appears in our catalog under these names: 2-Methyl-5-nitrophenol, 98%, 2-Methyl-5-nitrophenol, >95% (HPLC), 2–Methyl–5–nitrophenol, 5-Nitro-o-cresol, >98.0%(GC)(T), 2-Methyl-5-nitrophenol, 98%, 98%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Chemat. Available pack sizes: 100g, 25g, 5g, 10g, 1g, 500g.
2-methyl-5-nitrophenol (CAS 5428-54-6) is a chemical compound with the molecular formula C7H7NO3 and a molecular weight of 153.14 g/mol. IUPAC name: 2-methyl-5-nitrophenol. InChIKey: UMFDLIXUUJMPSI-UHFFFAOYSA-N.
| Molecular formula | C7H7NO3 |
|---|---|
| Molecular weight | 153.14 g/mol |
| IUPAC name | 2-methyl-5-nitrophenol |
| InChIKey | UMFDLIXUUJMPSI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)[N+](=O)[O-])O |
Computed by PubChem (NCBI)