Products 1207457-37-1
CAS 1207457-37-1 is the registry number for Suc-CBT. Offered by: Iris Biotech. Available pack sizes: 100mg, 250mg, 1g.
4-[(2-cyano-1,3-benzothiazol-6-yl)amino]-4-oxobutanoic acid (CAS 1207457-37-1) is a chemical compound with the molecular formula C12H9N3O3S and a molecular weight of 275.29 g/mol. IUPAC name: 4-[(2-cyano-1,3-benzothiazol-6-yl)amino]-4-oxobutanoic acid. InChIKey: FYLWLHKOYWQHFS-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O3S |
|---|---|
| Molecular weight | 275.29 g/mol |
| IUPAC name | 4-[(2-cyano-1,3-benzothiazol-6-yl)amino]-4-oxobutanoic acid |
| InChIKey | FYLWLHKOYWQHFS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1NC(=O)CCC(=O)O)SC(=N2)C#N |
Computed by PubChem (NCBI)