CAS 565210-75-5 appears in our catalog under these names: 3-((4H-1,2,4-Triazol-3-ylsulfanyl)methyl)-1-benzofuran-2-carboxylic acid, 95%, 3-((4H-1,2,4-Triazol-3-ylsulfanyl)methyl)-1-benzofuran-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
3-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1-benzofuran-2-carboxylic acid (CAS 565210-75-5) is a chemical compound with the molecular formula C12H9N3O3S and a molecular weight of 275.29 g/mol. IUPAC name: 3-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1-benzofuran-2-carboxylic acid. InChIKey: PALBENMSWBWCBQ-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O3S |
|---|---|
| Molecular weight | 275.29 g/mol |
| IUPAC name | 3-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1-benzofuran-2-carboxylic acid |
| InChIKey | PALBENMSWBWCBQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(O2)C(=O)O)CSC3=NC=NN3 |
Computed by PubChem (NCBI)