CAS 925437-85-0 appears in our catalog under these names: 6-(2-Nitrophenyl)imidazo[2,1-b]thiazole-3-methanol, 95%, 95%, 3-Hydroxymethyl-6-(2-nitrophenyl)imidazo[2,1-b]thiazole, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
[6-(2-nitrophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]methanol (CAS 925437-85-0) is a chemical compound with the molecular formula C12H9N3O3S and a molecular weight of 275.29 g/mol. IUPAC name: [6-(2-nitrophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]methanol. InChIKey: LENIQRDFJNQECM-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O3S |
|---|---|
| Molecular weight | 275.29 g/mol |
| IUPAC name | [6-(2-nitrophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]methanol |
| InChIKey | LENIQRDFJNQECM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CN3C(=CSC3=N2)CO)[N+](=O)[O-] |
Computed by PubChem (NCBI)