CAS 1207512-32-0 appears in our catalog under these names: (2R,3R)-2-(Benzoyloxy)-3-((4-methylbenzoyl)oxy) Butanedioic Acid, (2R,3R)-2-(benzoyloxy)-3-((4-methylbenzoyl)oxy)succinic acid, Ramipril Impurity 25. Offered by: Chemat Brand, HPC Standards. Available pack sizes: on request, 1x50mg.
(2R,3R)-2-benzoyloxy-3-(4-methylbenzoyl)oxybutanedioic acid (CAS 1207512-32-0) is a chemical compound with the molecular formula C19H16O8 and a molecular weight of 372.3 g/mol. IUPAC name: (2R,3R)-2-benzoyloxy-3-(4-methylbenzoyl)oxybutanedioic acid. InChIKey: SVKBRTOQRBWOGY-HUUCEWRRSA-N.
| Molecular formula | C19H16O8 |
|---|---|
| Molecular weight | 372.3 g/mol |
| IUPAC name | (2R,3R)-2-benzoyloxy-3-(4-methylbenzoyl)oxybutanedioic acid |
| InChIKey | SVKBRTOQRBWOGY-HUUCEWRRSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)O[C@H]([C@H](C(=O)O)OC(=O)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)