Products 914462-77-4
CAS 914462-77-4 is the registry number for Salvianolic Acid M. Offered by: TRC. Available pack sizes: 2,5mg.
3-(3,4-dihydroxyphenyl)-4-[(3-hydroxy-4-methoxyphenyl)methylidene]-5-oxooxolane-2-carboxylic acid (CAS 914462-77-4) is a chemical compound with the molecular formula C19H16O8 and a molecular weight of 372.3 g/mol. IUPAC name: 3-(3,4-dihydroxyphenyl)-4-[(3-hydroxy-4-methoxyphenyl)methylidene]-5-oxooxolane-2-carboxylic acid. InChIKey: TUHODGIPFMDZNK-UHFFFAOYSA-N.
| Molecular formula | C19H16O8 |
|---|---|
| Molecular weight | 372.3 g/mol |
| IUPAC name | 3-(3,4-dihydroxyphenyl)-4-[(3-hydroxy-4-methoxyphenyl)methylidene]-5-oxooxolane-2-carboxylic acid |
| InChIKey | TUHODGIPFMDZNK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C=C2C(C(OC2=O)C(=O)O)C3=CC(=C(C=C3)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Salvianolic Acid M