CAS 98819-55-7 is the registry number for (2S,3S)-2,3-Bis(benzoyloxy)-4-methoxy-4-oxobutanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3S)-2,3-dibenzoyloxy-4-methoxy-4-oxobutanoic acid (CAS 98819-55-7) is a chemical compound with the molecular formula C19H16O8 and a molecular weight of 372.3 g/mol. IUPAC name: (2S,3S)-2,3-dibenzoyloxy-4-methoxy-4-oxobutanoic acid. InChIKey: ALDQYCRVWHGEFT-GJZGRUSLSA-N.
| Molecular formula | C19H16O8 |
|---|---|
| Molecular weight | 372.3 g/mol |
| IUPAC name | (2S,3S)-2,3-dibenzoyloxy-4-methoxy-4-oxobutanoic acid |
| InChIKey | ALDQYCRVWHGEFT-GJZGRUSLSA-N |
| SMILES | COC(=O)[C@H]([C@@H](C(=O)O)OC(=O)C1=CC=CC=C1)OC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)