Products 1207665-71-1
CAS 1207665-71-1 is the registry number for Methyl 4-methyl-3-((4-(pyrazin-2-yl)pyrimidin-2-yl)amino)benzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl 4-methyl-3-[(4-pyrazin-2-ylpyrimidin-2-yl)amino]benzoate (CAS 1207665-71-1) is a chemical compound with the molecular formula C17H15N5O2 and a molecular weight of 321.33 g/mol. IUPAC name: methyl 4-methyl-3-[(4-pyrazin-2-ylpyrimidin-2-yl)amino]benzoate. InChIKey: XAUFRDIUEMFYLB-UHFFFAOYSA-N.
| Molecular formula | C17H15N5O2 |
|---|---|
| Molecular weight | 321.33 g/mol |
| IUPAC name | methyl 4-methyl-3-[(4-pyrazin-2-ylpyrimidin-2-yl)amino]benzoate |
| InChIKey | XAUFRDIUEMFYLB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)OC)NC2=NC=CC(=N2)C3=NC=CN=C3 |
Computed by PubChem (NCBI)