Products 954147-16-1

CAS 954147-16-1 is the registry number for 9H-Fluoren-9-ylmethyl N-(1H-1,2,3,4-tetrazol-5-ylmethyl)carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

9H-fluoren-9-ylmethyl N-(2H-tetrazol-5-ylmethyl)carbamate (CAS 954147-16-1) is a chemical compound with the molecular formula C17H15N5O2 and a molecular weight of 321.33 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-(2H-tetrazol-5-ylmethyl)carbamate. InChIKey: LNMWKUOAUJWUPR-UHFFFAOYSA-N.

Identity
Molecular formulaC17H15N5O2
Molecular weight321.33 g/mol
IUPAC name9H-fluoren-9-ylmethyl N-(2H-tetrazol-5-ylmethyl)carbamate
InChIKeyLNMWKUOAUJWUPR-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC4=NNN=N4

Computed by PubChem (NCBI)