CAS 2511541-78-7 is the registry number for USP30-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[(3R,5R)-1-cyano-5-methylpyrrolidin-3-yl]-5-(3-cyanophenyl)-1,3-oxazole-2-carboxamide (CAS 2511541-78-7) is a chemical compound with the molecular formula C17H15N5O2 and a molecular weight of 321.33 g/mol. IUPAC name: N-[(3R,5R)-1-cyano-5-methylpyrrolidin-3-yl]-5-(3-cyanophenyl)-1,3-oxazole-2-carboxamide. InChIKey: RNFCDLMNQAEONR-BXUZGUMPSA-N.
| Molecular formula | C17H15N5O2 |
|---|---|
| Molecular weight | 321.33 g/mol |
| IUPAC name | N-[(3R,5R)-1-cyano-5-methylpyrrolidin-3-yl]-5-(3-cyanophenyl)-1,3-oxazole-2-carboxamide |
| InChIKey | RNFCDLMNQAEONR-BXUZGUMPSA-N |
| SMILES | C[C@@H]1C[C@H](CN1C#N)NC(=O)C2=NC=C(O2)C3=CC=CC(=C3)C#N |
Computed by PubChem (NCBI)